C11H14O5 — CID 57041223
3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-ene-1,1-diol (PubChem CID 57041223) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is 3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-ene-1,1-diol.
| Compound Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-ene-1,1-diol |
|---|---|
| PubChem CID | 57041223 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-ene-1,1-diol |
| SMILES | COc1cc(C=CC(O)O)cc(OC)c1O |
| InChI | InChI=1S/C11H14O5/c1-15-8-5-7(3-4-10(12)13)6-9(16-2)11(8)14/h3-6,10,12-14H,1-2H3 |
| InChIKey | KSILAUWRXMUTHQ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|