C13H18O4 — CID 13436193
4-[(E)-3-ethoxyprop-1-enyl]-2,6-dimethoxyphenol (PubChem CID 13436193) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 4-[(E)-3-ethoxyprop-1-enyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(E)-3-ethoxyprop-1-enyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 13436193 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 4-[(E)-3-ethoxyprop-1-enyl]-2,6-dimethoxyphenol |
| SMILES | CCOC/C=C/c1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C13H18O4/c1-4-17-7-5-6-10-8-11(15-2)13(14)12(9-10)16-3/h5-6,8-9,14H,4,7H2,1-3H3/b6-5+ |
| InChIKey | PDGKZRKYANDFKV-AATRIKPKSA-N |
| XLogP | 2.46 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|