C15H18O5 — CID 139950809
3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enyl 2-methylprop-2-enoate (PubChem CID 139950809) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is 3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enyl 2-methylprop-2-enoate.
| Compound Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139950809 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC=Cc1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C15H18O5/c1-10(2)15(17)20-7-5-6-11-8-12(18-3)14(16)13(9-11)19-4/h5-6,8-9,16H,1,7H2,2-4H3 |
| InChIKey | OEMXUVLPSLDTFW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|