C17H20O4 — CID 137350549
2-methylprop-2-enoic acid;3-phenylprop-2-enyl 2-methylprop-2-enoate (PubChem CID 137350549) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;3-phenylprop-2-enyl 2-methylprop-2-enoate.
| Compound Name | 2-methylprop-2-enoic acid;3-phenylprop-2-enyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 137350549 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2-methylprop-2-enoic acid;3-phenylprop-2-enyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OCC=Cc1ccccc1 |
| InChI | InChI=1S/C13H14O2.C4H6O2/c1-11(2)13(14)15-10-6-9-12-7-4-3-5-8-12;1-3(2)4(5)6/h3-9H,1,10H2,2H3;1H2,2H3,(H,5,6) |
| InChIKey | HKTLYWJDUOJVEI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|