About 3-phenylprop-2-enyl 2-(chloromethyl)prop-2-enoate
3-phenylprop-2-enyl 2-(chloromethyl)prop-2-enoate (PubChem CID 57238060) has the molecular formula C13H13ClO2
and a molecular weight of 236.70 g/mol. Its IUPAC name is 3-phenylprop-2-enyl 2-(chloromethyl)prop-2-enoate.
Molecular Properties
| Compound Name | 3-phenylprop-2-enyl 2-(chloromethyl)prop-2-enoate |
| PubChem CID | 57238060 |
| Molecular Formula | C13H13ClO2 |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 3-phenylprop-2-enyl 2-(chloromethyl)prop-2-enoate |
| SMILES | C=C(CCl)C(=O)OCC=Cc1ccccc1 |
| InChI | InChI=1S/C13H13ClO2/c1-11(10-14)13(15)16-9-5-8-12-6-3-2-4-7-12/h2-8H,1,9-10H2 |
| InChIKey | ACCVDEVWOIUFIE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylprop-2-enyl 2-(chloromethyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylprop-2-enyl 2-(chloromethyl)prop-2-enoate?
The IUPAC name of 3-phenylprop-2-enyl 2-(chloromethyl)prop-2-enoate (CID 57238060) is 3-phenylprop-2-enyl 2-(chloromethyl)prop-2-enoate.
What is the SMILES notation for 3-phenylprop-2-enyl 2-(chloromethyl)prop-2-enoate?
The canonical SMILES for 3-phenylprop-2-enyl 2-(chloromethyl)prop-2-enoate is C=C(CCl)C(=O)OCC=Cc1ccccc1.
What is the InChIKey of 3-phenylprop-2-enyl 2-(chloromethyl)prop-2-enoate?
The InChIKey is ACCVDEVWOIUFIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClO2/c1-11(10-14)13(15)16-9-5-8-12-6-3-2-4-7-12/h2-8H,1,9-10H2.
What are the key properties of 3-phenylprop-2-enyl 2-(chloromethyl)prop-2-enoate?
3-phenylprop-2-enyl 2-(chloromethyl)prop-2-enoate has a molecular weight of 236.70 g/mol, XLogP of 3.04, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylprop-2-enyl 2-(chloromethyl)prop-2-enoate is sourced from PubChem (CID 57238060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).