About 3-phenylprop-2-enyl butanoate;[(E)-3-phenylprop-2-enyl] butanoate
3-phenylprop-2-enyl butanoate;[(E)-3-phenylprop-2-enyl] butanoate (PubChem CID 89428693) has the molecular formula C26H32O4
and a molecular weight of 408.54 g/mol. Its IUPAC name is 3-phenylprop-2-enyl butanoate;[(E)-3-phenylprop-2-enyl] butanoate.
Molecular Properties
| Compound Name | 3-phenylprop-2-enyl butanoate;[(E)-3-phenylprop-2-enyl] butanoate |
| PubChem CID | 89428693 |
| Molecular Formula | C26H32O4 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 3-phenylprop-2-enyl butanoate;[(E)-3-phenylprop-2-enyl] butanoate |
| SMILES | CCCC(=O)OC/C=C/c1ccccc1.CCCC(=O)OCC=Cc1ccccc1 |
| InChI | InChI=1S/2C13H16O2/c2*1-2-7-13(14)15-11-6-10-12-8-4-3-5-9-12/h2*3-6,8-10H,2,7,11H2,1H3/b10-6+; |
| InChIKey | PYDZFDVCHJORAM-AAGWESIMSA-N |
| XLogP | 6.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-phenylprop-2-enyl butanoate;[(E)-3-phenylprop-2-enyl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylprop-2-enyl butanoate;[(E)-3-phenylprop-2-enyl] butanoate?
The IUPAC name of 3-phenylprop-2-enyl butanoate;[(E)-3-phenylprop-2-enyl] butanoate (CID 89428693) is 3-phenylprop-2-enyl butanoate;[(E)-3-phenylprop-2-enyl] butanoate.
What is the SMILES notation for 3-phenylprop-2-enyl butanoate;[(E)-3-phenylprop-2-enyl] butanoate?
The canonical SMILES for 3-phenylprop-2-enyl butanoate;[(E)-3-phenylprop-2-enyl] butanoate is CCCC(=O)OC/C=C/c1ccccc1.CCCC(=O)OCC=Cc1ccccc1.
What is the InChIKey of 3-phenylprop-2-enyl butanoate;[(E)-3-phenylprop-2-enyl] butanoate?
The InChIKey is PYDZFDVCHJORAM-AAGWESIMSA-N. The full InChI is InChI=1S/2C13H16O2/c2*1-2-7-13(14)15-11-6-10-12-8-4-3-5-9-12/h2*3-6,8-10H,2,7,11H2,1H3/b10-6+;.
What are the key properties of 3-phenylprop-2-enyl butanoate;[(E)-3-phenylprop-2-enyl] butanoate?
3-phenylprop-2-enyl butanoate;[(E)-3-phenylprop-2-enyl] butanoate has a molecular weight of 408.54 g/mol, XLogP of 6.09, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylprop-2-enyl butanoate;[(E)-3-phenylprop-2-enyl] butanoate is sourced from PubChem (CID 89428693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).