About methane;[(E)-3-phenylprop-2-enyl] acetate
methane;[(E)-3-phenylprop-2-enyl] acetate (PubChem CID 161124319) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is methane;[(E)-3-phenylprop-2-enyl] acetate.
Molecular Properties
| Compound Name | methane;[(E)-3-phenylprop-2-enyl] acetate |
| PubChem CID | 161124319 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | methane;[(E)-3-phenylprop-2-enyl] acetate |
| SMILES | C.CC(=O)OC/C=C/c1ccccc1 |
| InChI | InChI=1S/C11H12O2.CH4/c1-10(12)13-9-5-8-11-6-3-2-4-7-11;/h2-8H,9H2,1H3;1H4/b8-5+; |
| InChIKey | ULIYJGDFWIAXHN-HAAWTFQLSA-N |
| XLogP | 2.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;[(E)-3-phenylprop-2-enyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;[(E)-3-phenylprop-2-enyl] acetate?
The IUPAC name of methane;[(E)-3-phenylprop-2-enyl] acetate (CID 161124319) is methane;[(E)-3-phenylprop-2-enyl] acetate.
What is the SMILES notation for methane;[(E)-3-phenylprop-2-enyl] acetate?
The canonical SMILES for methane;[(E)-3-phenylprop-2-enyl] acetate is C.CC(=O)OC/C=C/c1ccccc1.
What is the InChIKey of methane;[(E)-3-phenylprop-2-enyl] acetate?
The InChIKey is ULIYJGDFWIAXHN-HAAWTFQLSA-N. The full InChI is InChI=1S/C11H12O2.CH4/c1-10(12)13-9-5-8-11-6-3-2-4-7-11;/h2-8H,9H2,1H3;1H4/b8-5+;.
What are the key properties of methane;[(E)-3-phenylprop-2-enyl] acetate?
methane;[(E)-3-phenylprop-2-enyl] acetate has a molecular weight of 192.26 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;[(E)-3-phenylprop-2-enyl] acetate is sourced from PubChem (CID 161124319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).