About 2-phenoxyethyl 2-methylpropanoate;3-phenylprop-2-enyl acetate
2-phenoxyethyl 2-methylpropanoate;3-phenylprop-2-enyl acetate (PubChem CID 160865157) has the molecular formula C23H28O5
and a molecular weight of 384.47 g/mol. Its IUPAC name is 2-phenoxyethyl 2-methylpropanoate;3-phenylprop-2-enyl acetate.
Molecular Properties
| Compound Name | 2-phenoxyethyl 2-methylpropanoate;3-phenylprop-2-enyl acetate |
| PubChem CID | 160865157 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 2-phenoxyethyl 2-methylpropanoate;3-phenylprop-2-enyl acetate |
| SMILES | CC(=O)OCC=Cc1ccccc1.CC(C)C(=O)OCCOc1ccccc1 |
| InChI | InChI=1S/C12H16O3.C11H12O2/c1-10(2)12(13)15-9-8-14-11-6-4-3-5-7-11;1-10(12)13-9-5-8-11-6-3-2-4-7-11/h3-7,10H,8-9H2,1-2H3;2-8H,9H2,1H3 |
| InChIKey | SKZXMYFENJXOHP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-phenoxyethyl 2-methylpropanoate;3-phenylprop-2-enyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxyethyl 2-methylpropanoate;3-phenylprop-2-enyl acetate?
The IUPAC name of 2-phenoxyethyl 2-methylpropanoate;3-phenylprop-2-enyl acetate (CID 160865157) is 2-phenoxyethyl 2-methylpropanoate;3-phenylprop-2-enyl acetate.
What is the SMILES notation for 2-phenoxyethyl 2-methylpropanoate;3-phenylprop-2-enyl acetate?
The canonical SMILES for 2-phenoxyethyl 2-methylpropanoate;3-phenylprop-2-enyl acetate is CC(=O)OCC=Cc1ccccc1.CC(C)C(=O)OCCOc1ccccc1.
What is the InChIKey of 2-phenoxyethyl 2-methylpropanoate;3-phenylprop-2-enyl acetate?
The InChIKey is SKZXMYFENJXOHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3.C11H12O2/c1-10(2)12(13)15-9-8-14-11-6-4-3-5-7-11;1-10(12)13-9-5-8-11-6-3-2-4-7-11/h3-7,10H,8-9H2,1-2H3;2-8H,9H2,1H3.
What are the key properties of 2-phenoxyethyl 2-methylpropanoate;3-phenylprop-2-enyl acetate?
2-phenoxyethyl 2-methylpropanoate;3-phenylprop-2-enyl acetate has a molecular weight of 384.47 g/mol, XLogP of 4.53, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxyethyl 2-methylpropanoate;3-phenylprop-2-enyl acetate is sourced from PubChem (CID 160865157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).