C31H32O4 — CID 174922543
[(E)-3-phenylprop-2-enyl] butanoate;[(E)-3-phenylprop-2-enyl] (E)-3-phenylprop-2-enoate (PubChem CID 174922543) has the molecular formula C31H32O4 and a molecular weight of 468.59 g/mol. Its IUPAC name is [(E)-3-phenylprop-2-enyl] butanoate;[(E)-3-phenylprop-2-enyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(E)-3-phenylprop-2-enyl] butanoate;[(E)-3-phenylprop-2-enyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 174922543 |
| Molecular Formula | C31H32O4 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | [(E)-3-phenylprop-2-enyl] butanoate;[(E)-3-phenylprop-2-enyl] (E)-3-phenylprop-2-enoate |
| SMILES | CCCC(=O)OC/C=C/c1ccccc1.O=C(/C=C/c1ccccc1)OC/C=C/c1ccccc1 |
| InChI | InChI=1S/C18H16O2.C13H16O2/c19-18(14-13-17-10-5-2-6-11-17)20-15-7-12-16-8-3-1-4-9-16;1-2-7-13(14)15-11-6-10-12-8-4-3-5-9-12/h1-14H,15H2;3-6,8-10H,2,7,11H2,1H3/b12-7+,14-13+;10-6+ |
| InChIKey | NAUCQDHSMRSOQW-IZLWAWKNSA-N |
| XLogP | 7.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|