C20H18O2 — CID 53253335
[(2E,4E)-5-phenylpenta-2,4-dienyl] (E)-3-phenylprop-2-enoate (PubChem CID 53253335) has the molecular formula C20H18O2 and a molecular weight of 290.36 g/mol. Its IUPAC name is [(2E,4E)-5-phenylpenta-2,4-dienyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(2E,4E)-5-phenylpenta-2,4-dienyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 53253335 |
| Molecular Formula | C20H18O2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | [(2E,4E)-5-phenylpenta-2,4-dienyl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)OC/C=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H18O2/c21-20(16-15-19-13-6-2-7-14-19)22-17-9-3-8-12-18-10-4-1-5-11-18/h1-16H,17H2/b9-3+,12-8+,16-15+ |
| InChIKey | XTTWBZGTELAONR-VFQUOIRDSA-N |
| XLogP | 4.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|