C16H14O2 — CID 131878214
(2,3,4,5,6-pentadeuteriophenyl)methyl 3-phenylprop-2-enoate (PubChem CID 131878214) has the molecular formula C16H14O2 and a molecular weight of 243.32 g/mol. Its IUPAC name is (2,3,4,5,6-pentadeuteriophenyl)methyl 3-phenylprop-2-enoate.
| Compound Name | (2,3,4,5,6-pentadeuteriophenyl)methyl 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 131878214 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 243.32 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (2,3,4,5,6-pentadeuteriophenyl)methyl 3-phenylprop-2-enoate |
| SMILES | [2H]c1c([2H])c([2H])c(COC(=O)C=Cc2ccccc2)c([2H])c1[2H] |
| InChI | InChI=1S/C16H14O2/c17-16(12-11-14-7-3-1-4-8-14)18-13-15-9-5-2-6-10-15/h1-12H,13H2/i2D,5D,6D,9D,10D |
| InChIKey | NGHOLYJTSCBCGC-OUHXUHDZSA-N |
| XLogP | 3.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|