C13H18N2O4 — CID 170875955
(E)-3-amino-5-(4-hydroxy-3,5-dimethoxyphenyl)pent-4-enamide (PubChem CID 170875955) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is (E)-3-amino-5-(4-hydroxy-3,5-dimethoxyphenyl)pent-4-enamide.
| Compound Name | (E)-3-amino-5-(4-hydroxy-3,5-dimethoxyphenyl)pent-4-enamide |
|---|---|
| PubChem CID | 170875955 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (E)-3-amino-5-(4-hydroxy-3,5-dimethoxyphenyl)pent-4-enamide |
| SMILES | COc1cc(/C=C/C(N)CC(N)=O)cc(OC)c1O |
| InChI | InChI=1S/C13H18N2O4/c1-18-10-5-8(6-11(19-2)13(10)17)3-4-9(14)7-12(15)16/h3-6,9,17H,7,14H2,1-2H3,(H2,15,16)/b4-3+ |
| InChIKey | BMHYTCZXPBDOQI-ONEGZZNKSA-N |
| XLogP | 0.63 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |