C13H14O4 — CID 68601857
1-(4-hydroxy-3,5-dimethoxyphenyl)penta-1,4-dien-3-one (PubChem CID 68601857) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is 1-(4-hydroxy-3,5-dimethoxyphenyl)penta-1,4-dien-3-one.
| Compound Name | 1-(4-hydroxy-3,5-dimethoxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 68601857 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 1-(4-hydroxy-3,5-dimethoxyphenyl)penta-1,4-dien-3-one |
| SMILES | C=CC(=O)C=Cc1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C13H14O4/c1-4-10(14)6-5-9-7-11(16-2)13(15)12(8-9)17-3/h4-8,15H,1H2,2-3H3 |
| InChIKey | GARXAMQTMFNMSQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|