C14H12O9-2 — CID 20980847
2-hydroxy-2-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]propanedioate (PubChem CID 20980847) has the molecular formula C14H12O9-2 and a molecular weight of 324.24 g/mol. Its IUPAC name is 2-hydroxy-2-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]propanedioate.
| Compound Name | 2-hydroxy-2-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]propanedioate |
|---|---|
| PubChem CID | 20980847 |
| Molecular Formula | C14H12O9-2 |
| Molecular Weight | 324.24 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2-hydroxy-2-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]propanedioate |
| SMILES | COc1cc(C=CC(=O)C(O)(C(=O)[O-])C(=O)[O-])cc(OC)c1O |
| InChI | InChI=1S/C14H14O9/c1-22-8-5-7(6-9(23-2)11(8)16)3-4-10(15)14(21,12(17)18)13(19)20/h3-6,16,21H,1-2H3,(H,17,18)(H,19,20)/p-2 |
| InChIKey | MBKIONYLGFXLRP-UHFFFAOYSA-L |
| XLogP | -2.78 |
| TPSA | 156.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.24 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|