C16H23O7P — CID 85121259
4-dimethoxyphosphoryl-1-(4-hydroxy-3,5-dimethoxyphenyl)-4-methylpent-1-en-3-one (PubChem CID 85121259) has the molecular formula C16H23O7P and a molecular weight of 358.33 g/mol. Its IUPAC name is 4-dimethoxyphosphoryl-1-(4-hydroxy-3,5-dimethoxyphenyl)-4-methylpent-1-en-3-one.
| Compound Name | 4-dimethoxyphosphoryl-1-(4-hydroxy-3,5-dimethoxyphenyl)-4-methylpent-1-en-3-one |
|---|---|
| PubChem CID | 85121259 |
| Molecular Formula | C16H23O7P |
| Molecular Weight | 358.33 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 4-dimethoxyphosphoryl-1-(4-hydroxy-3,5-dimethoxyphenyl)-4-methylpent-1-en-3-one |
| SMILES | COc1cc(C=CC(=O)C(C)(C)P(=O)(OC)OC)cc(OC)c1O |
| InChI | InChI=1S/C16H23O7P/c1-16(2,24(19,22-5)23-6)14(17)8-7-11-9-12(20-3)15(18)13(10-11)21-4/h7-10,18H,1-6H3 |
| InChIKey | NOFIRHXDPIREME-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|