About (E)-4-(3,5-ditert-butylphenyl)-1-dimethoxyphosphoryl-1,1-difluorobut-3-en-2-one
(E)-4-(3,5-ditert-butylphenyl)-1-dimethoxyphosphoryl-1,1-difluorobut-3-en-2-one (PubChem CID 10069674) has the molecular formula C20H29F2O4P
and a molecular weight of 402.42 g/mol. Its IUPAC name is (E)-4-(3,5-ditert-butylphenyl)-1-dimethoxyphosphoryl-1,1-difluorobut-3-en-2-one.
Molecular Properties
| Compound Name | (E)-4-(3,5-ditert-butylphenyl)-1-dimethoxyphosphoryl-1,1-difluorobut-3-en-2-one |
| PubChem CID | 10069674 |
| Molecular Formula | C20H29F2O4P |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (E)-4-(3,5-ditert-butylphenyl)-1-dimethoxyphosphoryl-1,1-difluorobut-3-en-2-one |
| SMILES | COP(=O)(OC)C(F)(F)C(=O)/C=C/c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H29F2O4P/c1-18(2,3)15-11-14(12-16(13-15)19(4,5)6)9-10-17(23)20(21,22)27(24,25-7)26-8/h9-13H,1-8H3/b10-9+ |
| InChIKey | UFIWITMSIJEWNG-MDZDMXLPSA-N |
| XLogP | 5.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(3,5-ditert-butylphenyl)-1-dimethoxyphosphoryl-1,1-difluorobut-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(3,5-ditert-butylphenyl)-1-dimethoxyphosphoryl-1,1-difluorobut-3-en-2-one?
The IUPAC name of (E)-4-(3,5-ditert-butylphenyl)-1-dimethoxyphosphoryl-1,1-difluorobut-3-en-2-one (CID 10069674) is (E)-4-(3,5-ditert-butylphenyl)-1-dimethoxyphosphoryl-1,1-difluorobut-3-en-2-one.
What is the SMILES notation for (E)-4-(3,5-ditert-butylphenyl)-1-dimethoxyphosphoryl-1,1-difluorobut-3-en-2-one?
The canonical SMILES for (E)-4-(3,5-ditert-butylphenyl)-1-dimethoxyphosphoryl-1,1-difluorobut-3-en-2-one is COP(=O)(OC)C(F)(F)C(=O)/C=C/c1cc(C(C)(C)C)cc(C(C)(C)C)c1.
What is the InChIKey of (E)-4-(3,5-ditert-butylphenyl)-1-dimethoxyphosphoryl-1,1-difluorobut-3-en-2-one?
The InChIKey is UFIWITMSIJEWNG-MDZDMXLPSA-N. The full InChI is InChI=1S/C20H29F2O4P/c1-18(2,3)15-11-14(12-16(13-15)19(4,5)6)9-10-17(23)20(21,22)27(24,25-7)26-8/h9-13H,1-8H3/b10-9+.
What are the key properties of (E)-4-(3,5-ditert-butylphenyl)-1-dimethoxyphosphoryl-1,1-difluorobut-3-en-2-one?
(E)-4-(3,5-ditert-butylphenyl)-1-dimethoxyphosphoryl-1,1-difluorobut-3-en-2-one has a molecular weight of 402.42 g/mol, XLogP of 5.94, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(3,5-ditert-butylphenyl)-1-dimethoxyphosphoryl-1,1-difluorobut-3-en-2-one is sourced from PubChem (CID 10069674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).