C23H36FO5P — CID 10321126
(E)-1-(3,5-ditert-butyl-2-hydroxyphenyl)-4-diethoxyphosphoryl-4-fluoropent-1-en-3-one (PubChem CID 10321126) has the molecular formula C23H36FO5P and a molecular weight of 442.51 g/mol. Its IUPAC name is (E)-1-(3,5-ditert-butyl-2-hydroxyphenyl)-4-diethoxyphosphoryl-4-fluoropent-1-en-3-one.
| Compound Name | (E)-1-(3,5-ditert-butyl-2-hydroxyphenyl)-4-diethoxyphosphoryl-4-fluoropent-1-en-3-one |
|---|---|
| PubChem CID | 10321126 |
| Molecular Formula | C23H36FO5P |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | (E)-1-(3,5-ditert-butyl-2-hydroxyphenyl)-4-diethoxyphosphoryl-4-fluoropent-1-en-3-one |
| SMILES | CCOP(=O)(OCC)C(C)(F)C(=O)/C=C/c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H36FO5P/c1-10-28-30(27,29-11-2)23(9,24)19(25)13-12-16-14-17(21(3,4)5)15-18(20(16)26)22(6,7)8/h12-15,26H,10-11H2,1-9H3/b13-12+ |
| InChIKey | WFSKAYCTJPEINJ-OUKQBFOZSA-N |
| XLogP | 6.52 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|