C23H34O5P+ — CID 87872797
[(E)-1-cyclopentyl-4-(3,5-ditert-butyl-2-hydroxyphenyl)-2-oxobut-3-enoxy]-hydroxy-oxophosphanium (PubChem CID 87872797) has the molecular formula C23H34O5P+ and a molecular weight of 421.49 g/mol. Its IUPAC name is [(E)-1-cyclopentyl-4-(3,5-ditert-butyl-2-hydroxyphenyl)-2-oxobut-3-enoxy]-hydroxy-oxophosphanium.
| Compound Name | [(E)-1-cyclopentyl-4-(3,5-ditert-butyl-2-hydroxyphenyl)-2-oxobut-3-enoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 87872797 |
| Molecular Formula | C23H34O5P+ |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | [(E)-1-cyclopentyl-4-(3,5-ditert-butyl-2-hydroxyphenyl)-2-oxobut-3-enoxy]-hydroxy-oxophosphanium |
| SMILES | CC(C)(C)c1cc(/C=C/C(=O)C(O[P+](=O)O)C2CCCC2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H33O5P/c1-22(2,3)17-13-16(20(25)18(14-17)23(4,5)6)11-12-19(24)21(28-29(26)27)15-9-7-8-10-15/h11-15,21H,7-10H2,1-6H3,(H-,24,25,26,27)/p+1 |
| InChIKey | CWQVSTQHXIPVCJ-UHFFFAOYSA-O |
| XLogP | 5.79 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|