C38H56CrN3O2- — CID 10985081
chromium;2,4-ditert-butyl-6-[(E)-2-[(1R,2R)-2-[(E)-2-(3,5-ditert-butyl-2-hydroxyphenyl)ethenyl]cyclohexyl]ethenyl]phenol;azide (PubChem CID 10985081) has the molecular formula C38H56CrN3O2- and a molecular weight of 638.88 g/mol. Its IUPAC name is chromium;2,4-ditert-butyl-6-[(E)-2-[(1R,2R)-2-[(E)-2-(3,5-ditert-butyl-2-hydroxyphenyl)ethenyl]cyclohexyl]ethenyl]phenol;azide.
| Compound Name | chromium;2,4-ditert-butyl-6-[(E)-2-[(1R,2R)-2-[(E)-2-(3,5-ditert-butyl-2-hydroxyphenyl)ethenyl]cyclohexyl]ethenyl]phenol;azide |
|---|---|
| PubChem CID | 10985081 |
| Molecular Formula | C38H56CrN3O2- |
| Molecular Weight | 638.88 g/mol |
| Exact Mass | 638.38 |
| IUPAC Name | chromium;2,4-ditert-butyl-6-[(E)-2-[(1R,2R)-2-[(E)-2-(3,5-ditert-butyl-2-hydroxyphenyl)ethenyl]cyclohexyl]ethenyl]phenol;azide |
| SMILES | CC(C)(C)c1cc(/C=C/[C@H]2CCCC[C@@H]2/C=C/c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1.[Cr].[N-]=[N+]=[N-] |
| InChI | InChI=1S/C38H56O2.Cr.N3/c1-35(2,3)29-21-27(33(39)31(23-29)37(7,8)9)19-17-25-15-13-14-16-26(25)18-20-28-22-30(36(4,5)6)24-32(34(28)40)38(10,11)12;;1-3-2/h17-26,39-40H,13-16H2,1-12H3;;/q;;-1/b19-17+,20-18+;;/t25-,26-;;/m1../s1 |
| InChIKey | GNBGDNZNUJQULS-KGCVKKRHSA-N |
| XLogP | 11.68 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.88 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|