C17H25NO2 — CID 170876665
(Z)-3-(3,5-ditert-butyl-2-hydroxyphenyl)prop-2-enamide (PubChem CID 170876665) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is (Z)-3-(3,5-ditert-butyl-2-hydroxyphenyl)prop-2-enamide.
| Compound Name | (Z)-3-(3,5-ditert-butyl-2-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 170876665 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (Z)-3-(3,5-ditert-butyl-2-hydroxyphenyl)prop-2-enamide |
| SMILES | CC(C)(C)c1cc(/C=C\C(N)=O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H25NO2/c1-16(2,3)12-9-11(7-8-14(18)19)15(20)13(10-12)17(4,5)6/h7-10,20H,1-6H3,(H2,18,19)/b8-7- |
| InChIKey | VUJYUKGRUTYJIB-FPLPWBNLSA-N |
| XLogP | 3.49 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|