C19H28KNO3 — CID 156678583
potassium 2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-2-methylpropanoate (PubChem CID 156678583) has the molecular formula C19H28KNO3 and a molecular weight of 357.54 g/mol. Its IUPAC name is potassium 2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-2-methylpropanoate.
| Compound Name | potassium 2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 156678583 |
| Molecular Formula | C19H28KNO3 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | potassium 2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-2-methylpropanoate |
| SMILES | CC(C)(/N=C/c1cc(C(C)(C)C)cc(C(C)(C)C)c1O)C(=O)[O-].[K+] |
| InChI | InChI=1S/C19H29NO3.K/c1-17(2,3)13-9-12(11-20-19(7,8)16(22)23)15(21)14(10-13)18(4,5)6;/h9-11,21H,1-8H3,(H,22,23);/q;+1/p-1/b20-11+; |
| InChIKey | BNHPMJUTIZNFMS-DOELHFPHSA-M |
| XLogP | -0.06 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|