C24H33NO2 — CID 136693869
2,4-ditert-butyl-6-[[(2R)-1-hydroxy-2-phenylpropan-2-yl]iminomethyl]phenol (PubChem CID 136693869) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[(2R)-1-hydroxy-2-phenylpropan-2-yl]iminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[(2R)-1-hydroxy-2-phenylpropan-2-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 136693869 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 2,4-ditert-butyl-6-[[(2R)-1-hydroxy-2-phenylpropan-2-yl]iminomethyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N/[C@@](C)(CO)c2ccccc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H33NO2/c1-22(2,3)19-13-17(21(27)20(14-19)23(4,5)6)15-25-24(7,16-26)18-11-9-8-10-12-18/h8-15,26-27H,16H2,1-7H3/b25-15+/t24-/m0/s1 |
| InChIKey | KJYZABDSIJIONU-SFFGGSCWSA-N |
| XLogP | 5.31 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|