C29H35NO2 — CID 135588587
2,4-ditert-butyl-6-[(2-hydroxy-1,2-diphenylethyl)iminomethyl]phenol (PubChem CID 135588587) has the molecular formula C29H35NO2 and a molecular weight of 429.60 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[(2-hydroxy-1,2-diphenylethyl)iminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[(2-hydroxy-1,2-diphenylethyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 135588587 |
| Molecular Formula | C29H35NO2 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | 2,4-ditert-butyl-6-[(2-hydroxy-1,2-diphenylethyl)iminomethyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N/C(c2ccccc2)C(O)c2ccccc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H35NO2/c1-28(2,3)23-17-22(26(31)24(18-23)29(4,5)6)19-30-25(20-13-9-7-10-14-20)27(32)21-15-11-8-12-16-21/h7-19,25,27,31-32H,1-6H3/b30-19+ |
| InChIKey | IXZSHYIACBWIFQ-NDZAJKAJSA-N |
| XLogP | 6.88 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|