C28H33NO — CID 135516520
2-(benzhydryliminomethyl)-4,6-ditert-butylphenol (PubChem CID 135516520) has the molecular formula C28H33NO and a molecular weight of 399.58 g/mol. Its IUPAC name is 2-(benzhydryliminomethyl)-4,6-ditert-butylphenol.
| Compound Name | 2-(benzhydryliminomethyl)-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 135516520 |
| Molecular Formula | C28H33NO |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | 2-(benzhydryliminomethyl)-4,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(/C=N/C(c2ccccc2)c2ccccc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H33NO/c1-27(2,3)23-17-22(26(30)24(18-23)28(4,5)6)19-29-25(20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-19,25,30H,1-6H3/b29-19+ |
| InChIKey | YITPSCAVWWDRJQ-VUTHCHCSSA-N |
| XLogP | 7.20 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|