C37H42N2O — CID 136880146
2,4-ditert-butyl-6-[[(1R,2R)-2-(1,3-dihydroisoindol-2-yl)-1,2-diphenylethyl]iminomethyl]phenol (PubChem CID 136880146) has the molecular formula C37H42N2O and a molecular weight of 530.76 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[(1R,2R)-2-(1,3-dihydroisoindol-2-yl)-1,2-diphenylethyl]iminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[(1R,2R)-2-(1,3-dihydroisoindol-2-yl)-1,2-diphenylethyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 136880146 |
| Molecular Formula | C37H42N2O |
| Molecular Weight | 530.76 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | 2,4-ditert-butyl-6-[[(1R,2R)-2-(1,3-dihydroisoindol-2-yl)-1,2-diphenylethyl]iminomethyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N/[C@H](c2ccccc2)[C@@H](c2ccccc2)N2Cc3ccccc3C2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C37H42N2O/c1-36(2,3)31-21-30(35(40)32(22-31)37(4,5)6)23-38-33(26-15-9-7-10-16-26)34(27-17-11-8-12-18-27)39-24-28-19-13-14-20-29(28)25-39/h7-23,33-34,40H,24-25H2,1-6H3/b38-23+/t33-,34-/m1/s1 |
| InChIKey | YYMPZAJXPDIPST-IMJXHMOWSA-N |
| XLogP | 8.90 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.76 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|