C35H41NO2 — CID 135466375
2-(1-adamantyl)-4-tert-butyl-6-[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]iminomethyl]phenol (PubChem CID 135466375) has the molecular formula C35H41NO2 and a molecular weight of 507.72 g/mol. Its IUPAC name is 2-(1-adamantyl)-4-tert-butyl-6-[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]iminomethyl]phenol.
| Compound Name | 2-(1-adamantyl)-4-tert-butyl-6-[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135466375 |
| Molecular Formula | C35H41NO2 |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 507.31 |
| IUPAC Name | 2-(1-adamantyl)-4-tert-butyl-6-[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]iminomethyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N/[C@@H](c2ccccc2)[C@H](O)c2ccccc2)c(O)c(C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C35H41NO2/c1-34(2,3)29-17-28(32(37)30(18-29)35-19-23-14-24(20-35)16-25(15-23)21-35)22-36-31(26-10-6-4-7-11-26)33(38)27-12-8-5-9-13-27/h4-13,17-18,22-25,31,33,37-38H,14-16,19-21H2,1-3H3/b36-22+/t23?,24?,25?,31-,33+,35?/m0/s1 |
| InChIKey | LXWIEJKXWRMRRF-HJUQJWIJSA-N |
| XLogP | 8.05 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|