C35H40FNO2 — CID 153236949
2-(1-adamantyl)-4-tert-butyl-6-[[2-(2-ethoxyphenyl)-6-fluorophenyl]iminomethyl]phenol (PubChem CID 153236949) has the molecular formula C35H40FNO2 and a molecular weight of 525.71 g/mol. Its IUPAC name is 2-(1-adamantyl)-4-tert-butyl-6-[[2-(2-ethoxyphenyl)-6-fluorophenyl]iminomethyl]phenol.
| Compound Name | 2-(1-adamantyl)-4-tert-butyl-6-[[2-(2-ethoxyphenyl)-6-fluorophenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 153236949 |
| Molecular Formula | C35H40FNO2 |
| Molecular Weight | 525.71 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | 2-(1-adamantyl)-4-tert-butyl-6-[[2-(2-ethoxyphenyl)-6-fluorophenyl]iminomethyl]phenol |
| SMILES | CCOc1ccccc1-c1cccc(F)c1/N=C/c1cc(C(C)(C)C)cc(C23CC4CC(CC(C4)C2)C3)c1O |
| InChI | InChI=1S/C35H40FNO2/c1-5-39-31-12-7-6-9-27(31)28-10-8-11-30(36)32(28)37-21-25-16-26(34(2,3)4)17-29(33(25)38)35-18-22-13-23(19-35)15-24(14-22)20-35/h6-12,16-17,21-24,38H,5,13-15,18-20H2,1-4H3/b37-21+ |
| InChIKey | WQRICZWCGDZHBV-FDALDRLYSA-N |
| XLogP | 9.11 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.71 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|