C33H36FNO2 — CID 157374442
2-(1-adamantyl)-6-[[2-fluoro-6-(2-methoxy-4,6-dimethylphenyl)phenyl]iminomethyl]-4-methylphenol (PubChem CID 157374442) has the molecular formula C33H36FNO2 and a molecular weight of 497.65 g/mol. Its IUPAC name is 2-(1-adamantyl)-6-[[2-fluoro-6-(2-methoxy-4,6-dimethylphenyl)phenyl]iminomethyl]-4-methylphenol.
| Compound Name | 2-(1-adamantyl)-6-[[2-fluoro-6-(2-methoxy-4,6-dimethylphenyl)phenyl]iminomethyl]-4-methylphenol |
|---|---|
| PubChem CID | 157374442 |
| Molecular Formula | C33H36FNO2 |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | 2-(1-adamantyl)-6-[[2-fluoro-6-(2-methoxy-4,6-dimethylphenyl)phenyl]iminomethyl]-4-methylphenol |
| SMILES | COc1cc(C)cc(C)c1-c1cccc(F)c1/N=C/c1cc(C)cc(C23CC4CC(CC(C4)C2)C3)c1O |
| InChI | InChI=1S/C33H36FNO2/c1-19-8-21(3)30(29(11-19)37-4)26-6-5-7-28(34)31(26)35-18-25-9-20(2)10-27(32(25)36)33-15-22-12-23(16-33)14-24(13-22)17-33/h5-11,18,22-24,36H,12-17H2,1-4H3/b35-18+ |
| InChIKey | GXDFNUSIBGGCQP-MWBNBJEGSA-N |
| XLogP | 8.35 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|