C24H28N2O — CID 169383181
2-(1-adamantyl)-4-methyl-6-[(phenylhydrazinylidene)methyl]phenol (PubChem CID 169383181) has the molecular formula C24H28N2O and a molecular weight of 360.50 g/mol. Its IUPAC name is 2-(1-adamantyl)-4-methyl-6-[(phenylhydrazinylidene)methyl]phenol.
| Compound Name | 2-(1-adamantyl)-4-methyl-6-[(phenylhydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 169383181 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 2-(1-adamantyl)-4-methyl-6-[(phenylhydrazinylidene)methyl]phenol |
| SMILES | Cc1cc(C=NNc2ccccc2)c(O)c(C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C24H28N2O/c1-16-7-20(15-25-26-21-5-3-2-4-6-21)23(27)22(8-16)24-12-17-9-18(13-24)11-19(10-17)14-24/h2-8,15,17-19,26-27H,9-14H2,1H3 |
| InChIKey | CMMVVDYUNRDZIO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|