C27H31CrF6NO2Sb- — CID 135405331
(1R,2S)-1-[[3-(1-adamantyl)-2-hydroxy-5-methylphenyl]methylideneamino]-2,3-dihydro-1H-inden-2-ol;chromium;hexafluoroantimony(1-) (PubChem CID 135405331) has the molecular formula C27H31CrF6NO2Sb- and a molecular weight of 689.29 g/mol. Its IUPAC name is (1R,2S)-1-[[3-(1-adamantyl)-2-hydroxy-5-methylphenyl]methylideneamino]-2,3-dihydro-1H-inden-2-ol;chromium;hexafluoroantimony(1-).
| Compound Name | (1R,2S)-1-[[3-(1-adamantyl)-2-hydroxy-5-methylphenyl]methylideneamino]-2,3-dihydro-1H-inden-2-ol;chromium;hexafluoroantimony(1-) |
|---|---|
| PubChem CID | 135405331 |
| Molecular Formula | C27H31CrF6NO2Sb- |
| Molecular Weight | 689.29 g/mol |
| Exact Mass | 688.07 |
| IUPAC Name | (1R,2S)-1-[[3-(1-adamantyl)-2-hydroxy-5-methylphenyl]methylideneamino]-2,3-dihydro-1H-inden-2-ol;chromium;hexafluoroantimony(1-) |
| SMILES | Cc1cc(/C=N\[C@@H]2c3ccccc3C[C@@H]2O)c(O)c(C23CC4CC(CC(C4)C2)C3)c1.F[Sb-](F)(F)(F)(F)F.[Cr] |
| InChI | InChI=1S/C27H31NO2.Cr.6FH.Sb/c1-16-6-21(15-28-25-22-5-3-2-4-20(22)11-24(25)29)26(30)23(7-16)27-12-17-8-18(13-27)10-19(9-17)14-27;;;;;;;;/h2-7,15,17-19,24-25,29-30H,8-14H2,1H3;;6*1H;/q;;;;;;;;+5/p-6/b28-15-;;;;;;;;/t17?,18?,19?,24-,25+,27?;;;;;;;;/m0......../s1 |
| InChIKey | AORVXYVWHKCVLS-MWPCXSBHSA-H |
| XLogP | 7.38 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.29 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|