C36H33N3O6 — CID 136862410
2,4,6-tris[[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]iminomethyl]benzene-1,3,5-triol (PubChem CID 136862410) has the molecular formula C36H33N3O6 and a molecular weight of 603.68 g/mol. Its IUPAC name is 2,4,6-tris[[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]iminomethyl]benzene-1,3,5-triol.
| Compound Name | 2,4,6-tris[[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]iminomethyl]benzene-1,3,5-triol |
|---|---|
| PubChem CID | 136862410 |
| Molecular Formula | C36H33N3O6 |
| Molecular Weight | 603.68 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | 2,4,6-tris[[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]iminomethyl]benzene-1,3,5-triol |
| SMILES | Oc1c(/C=N/[C@@H]2c3ccccc3C[C@@H]2O)c(O)c(/C=N/[C@@H]2c3ccccc3C[C@@H]2O)c(O)c1/C=N/[C@@H]1c2ccccc2C[C@@H]1O |
| InChI | InChI=1S/C36H33N3O6/c40-28-13-19-7-1-4-10-22(19)31(28)37-16-25-34(43)26(17-38-32-23-11-5-2-8-20(23)14-29(32)41)36(45)27(35(25)44)18-39-33-24-12-6-3-9-21(24)15-30(33)42/h1-12,16-18,28-33,40-45H,13-15H2/b37-16+,38-17+,39-18+/t28-,29-,30-,31+,32+,33+/m0/s1 |
| InChIKey | XBFVVDYHOYCBID-UIXOTUFUSA-N |
| XLogP | 4.03 |
| TPSA | 158.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.68 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|