C10H10Br2O — CID 125478754
(1R,2S)-1-(dibromomethyl)-2,3-dihydro-1H-inden-2-ol (PubChem CID 125478754) has the molecular formula C10H10Br2O and a molecular weight of 306.00 g/mol. Its IUPAC name is (1R,2S)-1-(dibromomethyl)-2,3-dihydro-1H-inden-2-ol.
| Compound Name | (1R,2S)-1-(dibromomethyl)-2,3-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 125478754 |
| Molecular Formula | C10H10Br2O |
| Molecular Weight | 306.00 g/mol |
| Exact Mass | 303.91 |
| IUPAC Name | (1R,2S)-1-(dibromomethyl)-2,3-dihydro-1H-inden-2-ol |
| SMILES | O[C@H]1Cc2ccccc2[C@H]1C(Br)Br |
| InChI | InChI=1S/C10H10Br2O/c11-10(12)9-7-4-2-1-3-6(7)5-8(9)13/h1-4,8-10,13H,5H2/t8-,9+/m0/s1 |
| InChIKey | FPYWIVIKLBUXEO-DTWKUNHWSA-N |
| XLogP | 2.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.00 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|