C11H12Br2O — CID 102321992
(1R,2R,3R)-2-bromo-3-(bromomethyl)-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 102321992) has the molecular formula C11H12Br2O and a molecular weight of 320.02 g/mol. Its IUPAC name is (1R,2R,3R)-2-bromo-3-(bromomethyl)-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | (1R,2R,3R)-2-bromo-3-(bromomethyl)-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 102321992 |
| Molecular Formula | C11H12Br2O |
| Molecular Weight | 320.02 g/mol |
| Exact Mass | 317.93 |
| IUPAC Name | (1R,2R,3R)-2-bromo-3-(bromomethyl)-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | O[C@@H]1c2ccccc2C[C@H](CBr)[C@H]1Br |
| InChI | InChI=1S/C11H12Br2O/c12-6-8-5-7-3-1-2-4-9(7)11(14)10(8)13/h1-4,8,10-11,14H,5-6H2/t8-,10-,11-/m1/s1 |
| InChIKey | YIXRNGZBGPPKLH-FBIMIBRVSA-N |
| XLogP | 3.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.02 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|