C14H19NO — CID 58393646
(2R)-2-(pyrrolidin-1-ylmethyl)-2,3-dihydro-1H-inden-1-ol (PubChem CID 58393646) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (2R)-2-(pyrrolidin-1-ylmethyl)-2,3-dihydro-1H-inden-1-ol.
| Compound Name | (2R)-2-(pyrrolidin-1-ylmethyl)-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 58393646 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (2R)-2-(pyrrolidin-1-ylmethyl)-2,3-dihydro-1H-inden-1-ol |
| SMILES | OC1c2ccccc2C[C@@H]1CN1CCCC1 |
| InChI | InChI=1S/C14H19NO/c16-14-12(10-15-7-3-4-8-15)9-11-5-1-2-6-13(11)14/h1-2,5-6,12,14,16H,3-4,7-10H2/t12-,14?/m1/s1 |
| InChIKey | HWLFKYQMLXLWCI-PUODRLBUSA-N |
| XLogP | 1.99 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |