C17H18OS — CID 79227500
2-(2-phenylsulfanylethyl)-2,3-dihydro-1H-inden-1-ol (PubChem CID 79227500) has the molecular formula C17H18OS and a molecular weight of 270.40 g/mol. Its IUPAC name is 2-(2-phenylsulfanylethyl)-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 2-(2-phenylsulfanylethyl)-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 79227500 |
| Molecular Formula | C17H18OS |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-(2-phenylsulfanylethyl)-2,3-dihydro-1H-inden-1-ol |
| SMILES | OC1c2ccccc2CC1CCSc1ccccc1 |
| InChI | InChI=1S/C17H18OS/c18-17-14(12-13-6-4-5-9-16(13)17)10-11-19-15-7-2-1-3-8-15/h1-9,14,17-18H,10-12H2 |
| InChIKey | CBDRTLJWWBIAPP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |