C9H10O2 — CID 68820122
(1S)-2,3-dihydro-1H-indene-1,2-diol (PubChem CID 68820122) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is (1S)-2,3-dihydro-1H-indene-1,2-diol.
| Compound Name | (1S)-2,3-dihydro-1H-indene-1,2-diol |
|---|---|
| PubChem CID | 68820122 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | (1S)-2,3-dihydro-1H-indene-1,2-diol |
| SMILES | OC1Cc2ccccc2[C@@H]1O |
| InChI | InChI=1S/C9H10O2/c10-8-5-6-3-1-2-4-7(6)9(8)11/h1-4,8-11H,5H2/t8?,9-/m0/s1 |
| InChIKey | YKXXBEOXRPZVCC-GKAPJAKFSA-N |
| XLogP | 0.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |