C12H14O — CID 130142398
1,2,2a,3,8,8a-hexahydrocyclobuta[b]naphthalen-3-ol (PubChem CID 130142398) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 1,2,2a,3,8,8a-hexahydrocyclobuta[b]naphthalen-3-ol.
| Compound Name | 1,2,2a,3,8,8a-hexahydrocyclobuta[b]naphthalen-3-ol |
|---|---|
| PubChem CID | 130142398 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 1,2,2a,3,8,8a-hexahydrocyclobuta[b]naphthalen-3-ol |
| SMILES | OC1c2ccccc2CC2CCC21 |
| InChI | InChI=1S/C12H14O/c13-12-10-4-2-1-3-8(10)7-9-5-6-11(9)12/h1-4,9,11-13H,5-7H2 |
| InChIKey | ZIDVCICHRGWJFP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |