C10H11NiO- — CID 177486756
(1S,2S)-2-methanidyl-2,3-dihydro-1H-inden-1-ol;nickel (PubChem CID 177486756) has the molecular formula C10H11NiO- and a molecular weight of 205.89 g/mol. Its IUPAC name is (1S,2S)-2-methanidyl-2,3-dihydro-1H-inden-1-ol;nickel.
| Compound Name | (1S,2S)-2-methanidyl-2,3-dihydro-1H-inden-1-ol;nickel |
|---|---|
| PubChem CID | 177486756 |
| Molecular Formula | C10H11NiO- |
| Molecular Weight | 205.89 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | (1S,2S)-2-methanidyl-2,3-dihydro-1H-inden-1-ol;nickel |
| SMILES | [CH2-][C@H]1Cc2ccccc2[C@H]1O.[Ni] |
| InChI | InChI=1S/C10H11O.Ni/c1-7-6-8-4-2-3-5-9(8)10(7)11;/h2-5,7,10-11H,1,6H2;/q-1;/t7-,10-;/m0./s1 |
| InChIKey | MVYZLIZEEDOISL-YUWZRIFDSA-N |
| XLogP | 1.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.89 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|