C9H9IO — CID 11821326
(1S,2S)-2-iodo-2,3-dihydro-1H-inden-1-ol (PubChem CID 11821326) has the molecular formula C9H9IO and a molecular weight of 260.07 g/mol. Its IUPAC name is (1S,2S)-2-iodo-2,3-dihydro-1H-inden-1-ol.
| Compound Name | (1S,2S)-2-iodo-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 11821326 |
| Molecular Formula | C9H9IO |
| Molecular Weight | 260.07 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | (1S,2S)-2-iodo-2,3-dihydro-1H-inden-1-ol |
| SMILES | O[C@H]1c2ccccc2C[C@@H]1I |
| InChI | InChI=1S/C9H9IO/c10-8-5-6-3-1-2-4-7(6)9(8)11/h1-4,8-9,11H,5H2/t8-,9-/m0/s1 |
| InChIKey | MMLBUWIACJPYPC-IUCAKERBSA-N |
| XLogP | 2.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.07 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|