C15H15NOS — CID 131842796
(1S,2S)-2-(2-aminophenyl)sulfanyl-2,3-dihydro-1H-inden-1-ol (PubChem CID 131842796) has the molecular formula C15H15NOS and a molecular weight of 257.36 g/mol. Its IUPAC name is (1S,2S)-2-(2-aminophenyl)sulfanyl-2,3-dihydro-1H-inden-1-ol.
| Compound Name | (1S,2S)-2-(2-aminophenyl)sulfanyl-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 131842796 |
| Molecular Formula | C15H15NOS |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | (1S,2S)-2-(2-aminophenyl)sulfanyl-2,3-dihydro-1H-inden-1-ol |
| SMILES | Nc1ccccc1S[C@H]1Cc2ccccc2[C@@H]1O |
| InChI | InChI=1S/C15H15NOS/c16-12-7-3-4-8-13(12)18-14-9-10-5-1-2-6-11(10)15(14)17/h1-8,14-15,17H,9,16H2/t14-,15-/m0/s1 |
| InChIKey | ODLMDDCMUJBEAY-GJZGRUSLSA-N |
| XLogP | 3.02 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|