C12H17NS — CID 64633837
2-propan-2-ylsulfanyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 64633837) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is 2-propan-2-ylsulfanyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 2-propan-2-ylsulfanyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 64633837 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2-propan-2-ylsulfanyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | CC(C)SC1Cc2ccccc2C1N |
| InChI | InChI=1S/C12H17NS/c1-8(2)14-11-7-9-5-3-4-6-10(9)12(11)13/h3-6,8,11-12H,7,13H2,1-2H3 |
| InChIKey | ZDKVFPKMXONBGN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |