C13H19NOS — CID 66135764
3-[(1-amino-2,3-dihydro-1H-inden-2-yl)sulfanyl]butan-1-ol (PubChem CID 66135764) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is 3-[(1-amino-2,3-dihydro-1H-inden-2-yl)sulfanyl]butan-1-ol.
| Compound Name | 3-[(1-amino-2,3-dihydro-1H-inden-2-yl)sulfanyl]butan-1-ol |
|---|---|
| PubChem CID | 66135764 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 3-[(1-amino-2,3-dihydro-1H-inden-2-yl)sulfanyl]butan-1-ol |
| SMILES | CC(CCO)SC1Cc2ccccc2C1N |
| InChI | InChI=1S/C13H19NOS/c1-9(6-7-15)16-12-8-10-4-2-3-5-11(10)13(12)14/h2-5,9,12-13,15H,6-8,14H2,1H3 |
| InChIKey | LWGHWYITRLXNQA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |