C9H12N2 — CID 10986398
2,3-dihydro-1H-indene-1,2-diamine (PubChem CID 10986398) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 2,3-dihydro-1H-indene-1,2-diamine.
| Compound Name | 2,3-dihydro-1H-indene-1,2-diamine |
|---|---|
| PubChem CID | 10986398 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 2,3-dihydro-1H-indene-1,2-diamine |
| SMILES | NC1Cc2ccccc2C1N |
| InChI | InChI=1S/C9H12N2/c10-8-5-6-3-1-2-4-7(6)9(8)11/h1-4,8-9H,5,10-11H2 |
| InChIKey | WDXURXJYTUFEPX-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |