C8H9N — CID 2753029
bicyclo[4.2.0]octa-1,3,5-trien-7-amine (PubChem CID 2753029) has the molecular formula C8H9N and a molecular weight of 119.17 g/mol. Its IUPAC name is bicyclo[4.2.0]octa-1,3,5-trien-7-amine.
| Compound Name | bicyclo[4.2.0]octa-1,3,5-trien-7-amine |
|---|---|
| PubChem CID | 2753029 |
| Molecular Formula | C8H9N |
| Molecular Weight | 119.17 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | bicyclo[4.2.0]octa-1,3,5-trien-7-amine |
| SMILES | NC1Cc2ccccc21 |
| InChI | InChI=1S/C8H9N/c9-8-5-6-3-1-2-4-7(6)8/h1-4,8H,5,9H2 |
| InChIKey | OVLLQUKHPTXIBH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.17 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |