C12H26N4 — CID 174570832
2,3-dihydro-1H-inden-1-amine;methanamine (PubChem CID 174570832) has the molecular formula C12H26N4 and a molecular weight of 226.37 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-1-amine;methanamine.
| Compound Name | 2,3-dihydro-1H-inden-1-amine;methanamine |
|---|---|
| PubChem CID | 174570832 |
| Molecular Formula | C12H26N4 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.22 |
| IUPAC Name | 2,3-dihydro-1H-inden-1-amine;methanamine |
| SMILES | CN.CN.CN.NC1CCc2ccccc21 |
| InChI | InChI=1S/C9H11N.3CH5N/c10-9-6-5-7-3-1-2-4-8(7)9;3*1-2/h1-4,9H,5-6,10H2;3*2H2,1H3 |
| InChIKey | YZXICJHGMOZWAI-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |