C17H28N2 — CID 91239309
2,3-dihydro-1H-inden-1-amine;2,2-dimethylhexan-3-imine (PubChem CID 91239309) has the molecular formula C17H28N2 and a molecular weight of 260.42 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-1-amine;2,2-dimethylhexan-3-imine.
| Compound Name | 2,3-dihydro-1H-inden-1-amine;2,2-dimethylhexan-3-imine |
|---|---|
| PubChem CID | 91239309 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 2,3-dihydro-1H-inden-1-amine;2,2-dimethylhexan-3-imine |
| SMILES | NC1CCc2ccccc21.[H]/N=C(\CCC)C(C)(C)C |
| InChI | InChI=1S/C9H11N.C8H17N/c10-9-6-5-7-3-1-2-4-8(7)9;1-5-6-7(9)8(2,3)4/h1-4,9H,5-6,10H2;9H,5-6H2,1-4H3/b;9-7+ |
| InChIKey | HPTQUSDDJVWFOK-FXDYKFNQSA-N |
| XLogP | 4.48 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|