C16H24N2O — CID 65252108
2,2-dimethyl-4-(1,2,3,4-tetrahydronaphthalen-1-yloxy)butanimidamide (PubChem CID 65252108) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 2,2-dimethyl-4-(1,2,3,4-tetrahydronaphthalen-1-yloxy)butanimidamide.
| Compound Name | 2,2-dimethyl-4-(1,2,3,4-tetrahydronaphthalen-1-yloxy)butanimidamide |
|---|---|
| PubChem CID | 65252108 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 2,2-dimethyl-4-(1,2,3,4-tetrahydronaphthalen-1-yloxy)butanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCOC1CCCc2ccccc21 |
| InChI | InChI=1S/C16H24N2O/c1-16(2,15(17)18)10-11-19-14-9-5-7-12-6-3-4-8-13(12)14/h3-4,6,8,14H,5,7,9-11H2,1-2H3,(H3,17,18) |
| InChIKey | QVPMSGPGLQFXOM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|