C14H21NO2 — CID 64814404
1-amino-4-(1,2,3,4-tetrahydronaphthalen-1-yloxy)butan-2-ol (PubChem CID 64814404) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-amino-4-(1,2,3,4-tetrahydronaphthalen-1-yloxy)butan-2-ol.
| Compound Name | 1-amino-4-(1,2,3,4-tetrahydronaphthalen-1-yloxy)butan-2-ol |
|---|---|
| PubChem CID | 64814404 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 1-amino-4-(1,2,3,4-tetrahydronaphthalen-1-yloxy)butan-2-ol |
| SMILES | NCC(O)CCOC1CCCc2ccccc21 |
| InChI | InChI=1S/C14H21NO2/c15-10-12(16)8-9-17-14-7-3-5-11-4-1-2-6-13(11)14/h1-2,4,6,12,14,16H,3,5,7-10,15H2 |
| InChIKey | UPMLZXMMRRDIKV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |