C18H21NO — CID 43519719
4-[2-(1,2,3,4-tetrahydronaphthalen-1-yloxy)ethyl]aniline (PubChem CID 43519719) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is 4-[2-(1,2,3,4-tetrahydronaphthalen-1-yloxy)ethyl]aniline.
| Compound Name | 4-[2-(1,2,3,4-tetrahydronaphthalen-1-yloxy)ethyl]aniline |
|---|---|
| PubChem CID | 43519719 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 4-[2-(1,2,3,4-tetrahydronaphthalen-1-yloxy)ethyl]aniline |
| SMILES | Nc1ccc(CCOC2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C18H21NO/c19-16-10-8-14(9-11-16)12-13-20-18-7-3-5-15-4-1-2-6-17(15)18/h1-2,4,6,8-11,18H,3,5,7,12-13,19H2 |
| InChIKey | SMKIVEAKNSWFAM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|