C17H18FNO — CID 43443892
4-fluoro-2-(1,2,3,4-tetrahydronaphthalen-1-yloxymethyl)aniline (PubChem CID 43443892) has the molecular formula C17H18FNO and a molecular weight of 271.34 g/mol. Its IUPAC name is 4-fluoro-2-(1,2,3,4-tetrahydronaphthalen-1-yloxymethyl)aniline.
| Compound Name | 4-fluoro-2-(1,2,3,4-tetrahydronaphthalen-1-yloxymethyl)aniline |
|---|---|
| PubChem CID | 43443892 |
| Molecular Formula | C17H18FNO |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 4-fluoro-2-(1,2,3,4-tetrahydronaphthalen-1-yloxymethyl)aniline |
| SMILES | Nc1ccc(F)cc1COC1CCCc2ccccc21 |
| InChI | InChI=1S/C17H18FNO/c18-14-8-9-16(19)13(10-14)11-20-17-7-3-5-12-4-1-2-6-15(12)17/h1-2,4,6,8-10,17H,3,5,7,11,19H2 |
| InChIKey | WCDNAWGMHGQUJZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|